C25H31NO3 — CID 85040824
5-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-4-pyridinyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 85040824) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 5-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-4-pyridinyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-4-pyridinyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 85040824 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 5-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-4-pyridinyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CCOc1c(-c2cnccc2C=CC(C)=CC(=O)O)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C25H31NO3/c1-7-29-25-21(17(4)5)13-20(16(2)3)14-22(25)23-15-26-11-10-19(23)9-8-18(6)12-24(27)28/h8-17H,7H2,1-6H3,(H,27,28) |
| InChIKey | MPPQDPPMOLDSQC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|