C26H32F4O3 — CID 85060845
5-[2-[3,5-di(propan-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)phenyl]cyclopenten-1-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 85060845) has the molecular formula C26H32F4O3 and a molecular weight of 468.53 g/mol. Its IUPAC name is 5-[2-[3,5-di(propan-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)phenyl]cyclopenten-1-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-[2-[3,5-di(propan-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)phenyl]cyclopenten-1-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 85060845 |
| Molecular Formula | C26H32F4O3 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 5-[2-[3,5-di(propan-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)phenyl]cyclopenten-1-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(C=CC1=C(c2cc(C(C)C)cc(C(C)C)c2OCC(F)(F)C(F)F)CCC1)=CC(=O)O |
| InChI | InChI=1S/C26H32F4O3/c1-15(2)19-12-21(16(3)4)24(33-14-26(29,30)25(27)28)22(13-19)20-8-6-7-18(20)10-9-17(5)11-23(31)32/h9-13,15-16,25H,6-8,14H2,1-5H3,(H,31,32) |
| InChIKey | TWHGDSDNYKIZBT-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|