C21H29FO2 — CID 10980503
2-[2-(3-fluoropropoxy)-3,5-di(propan-2-yl)phenyl]cyclopentene-1-carbaldehyde (PubChem CID 10980503) has the molecular formula C21H29FO2 and a molecular weight of 332.46 g/mol. Its IUPAC name is 2-[2-(3-fluoropropoxy)-3,5-di(propan-2-yl)phenyl]cyclopentene-1-carbaldehyde.
| Compound Name | 2-[2-(3-fluoropropoxy)-3,5-di(propan-2-yl)phenyl]cyclopentene-1-carbaldehyde |
|---|---|
| PubChem CID | 10980503 |
| Molecular Formula | C21H29FO2 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 2-[2-(3-fluoropropoxy)-3,5-di(propan-2-yl)phenyl]cyclopentene-1-carbaldehyde |
| SMILES | CC(C)c1cc(C2=C(C=O)CCC2)c(OCCCF)c(C(C)C)c1 |
| InChI | InChI=1S/C21H29FO2/c1-14(2)17-11-19(15(3)4)21(24-10-6-9-22)20(12-17)18-8-5-7-16(18)13-23/h11-15H,5-10H2,1-4H3 |
| InChIKey | JSMNTPUNBSRANN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|