C18H28O3S — CID 175284846
[2,4,6-tri(propan-2-yl)phenyl] prop-2-ene-1-sulfonate (PubChem CID 175284846) has the molecular formula C18H28O3S and a molecular weight of 324.49 g/mol. Its IUPAC name is [2,4,6-tri(propan-2-yl)phenyl] prop-2-ene-1-sulfonate.
| Compound Name | [2,4,6-tri(propan-2-yl)phenyl] prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 175284846 |
| Molecular Formula | C18H28O3S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | [2,4,6-tri(propan-2-yl)phenyl] prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)Oc1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C18H28O3S/c1-8-9-22(19,20)21-18-16(13(4)5)10-15(12(2)3)11-17(18)14(6)7/h8,10-14H,1,9H2,2-7H3 |
| InChIKey | VQLLREFRRKITMX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|