C22H34O — CID 135061596
2-[1-[(1Z)-penta-1,4-dienoxy]ethyl]-1,3,5-tri(propan-2-yl)benzene (PubChem CID 135061596) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is 2-[1-[(1Z)-penta-1,4-dienoxy]ethyl]-1,3,5-tri(propan-2-yl)benzene.
| Compound Name | 2-[1-[(1Z)-penta-1,4-dienoxy]ethyl]-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 135061596 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 2-[1-[(1Z)-penta-1,4-dienoxy]ethyl]-1,3,5-tri(propan-2-yl)benzene |
| SMILES | C=CC/C=C\OC(C)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C22H34O/c1-9-10-11-12-23-18(8)22-20(16(4)5)13-19(15(2)3)14-21(22)17(6)7/h9,11-18H,1,10H2,2-8H3/b12-11- |
| InChIKey | PBGGEHUREHWGDW-QXMHVHEDSA-N |
| XLogP | 7.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|