C22H34O — CID 134882548
2-[(1R)-1-[(1Z)-2-methylbuta-1,3-dienoxy]ethyl]-1,3,5-tri(propan-2-yl)benzene (PubChem CID 134882548) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is 2-[(1R)-1-[(1Z)-2-methylbuta-1,3-dienoxy]ethyl]-1,3,5-tri(propan-2-yl)benzene.
| Compound Name | 2-[(1R)-1-[(1Z)-2-methylbuta-1,3-dienoxy]ethyl]-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 134882548 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 2-[(1R)-1-[(1Z)-2-methylbuta-1,3-dienoxy]ethyl]-1,3,5-tri(propan-2-yl)benzene |
| SMILES | C=C/C(C)=C\O[C@H](C)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C22H34O/c1-10-17(8)13-23-18(9)22-20(15(4)5)11-19(14(2)3)12-21(22)16(6)7/h10-16,18H,1H2,2-9H3/b17-13-/t18-/m1/s1 |
| InChIKey | BABCTDMWJGGCNJ-MTMYEVCSSA-N |
| XLogP | 7.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|