C26H36O — CID 135061019
2-[1-[(Z)-3-phenylprop-1-enoxy]ethyl]-1,3,5-tri(propan-2-yl)benzene (PubChem CID 135061019) has the molecular formula C26H36O and a molecular weight of 364.57 g/mol. Its IUPAC name is 2-[1-[(Z)-3-phenylprop-1-enoxy]ethyl]-1,3,5-tri(propan-2-yl)benzene.
| Compound Name | 2-[1-[(Z)-3-phenylprop-1-enoxy]ethyl]-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 135061019 |
| Molecular Formula | C26H36O |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | 2-[1-[(Z)-3-phenylprop-1-enoxy]ethyl]-1,3,5-tri(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(C(C)C)c(C(C)O/C=C\Cc2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C26H36O/c1-18(2)23-16-24(19(3)4)26(25(17-23)20(5)6)21(7)27-15-11-14-22-12-9-8-10-13-22/h8-13,15-21H,14H2,1-7H3/b15-11- |
| InChIKey | LIUWVUIXSOGVMK-PTNGSMBKSA-N |
| XLogP | 7.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|