C48H68O2P2 — CID 102041247
2-[benzyl-[4-[benzyl-[2,4,6-tri(propan-2-yl)phenyl]phosphoryl]butyl]phosphoryl]-1,3,5-tri(propan-2-yl)benzene (PubChem CID 102041247) has the molecular formula C48H68O2P2 and a molecular weight of 739.02 g/mol. Its IUPAC name is 2-[benzyl-[4-[benzyl-[2,4,6-tri(propan-2-yl)phenyl]phosphoryl]butyl]phosphoryl]-1,3,5-tri(propan-2-yl)benzene.
| Compound Name | 2-[benzyl-[4-[benzyl-[2,4,6-tri(propan-2-yl)phenyl]phosphoryl]butyl]phosphoryl]-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 102041247 |
| Molecular Formula | C48H68O2P2 |
| Molecular Weight | 739.02 g/mol |
| Exact Mass | 738.47 |
| IUPAC Name | 2-[benzyl-[4-[benzyl-[2,4,6-tri(propan-2-yl)phenyl]phosphoryl]butyl]phosphoryl]-1,3,5-tri(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(C(C)C)c(P(=O)(CCCCP(=O)(Cc2ccccc2)c2c(C(C)C)cc(C(C)C)cc2C(C)C)Cc2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C48H68O2P2/c1-33(2)41-27-43(35(5)6)47(44(28-41)36(7)8)51(49,31-39-21-15-13-16-22-39)25-19-20-26-52(50,32-40-23-17-14-18-24-40)48-45(37(9)10)29-42(34(3)4)30-46(48)38(11)12/h13-18,21-24,27-30,33-38H,19-20,25-26,31-32H2,1-12H3 |
| InChIKey | NRSLNXVPHAUYFU-UHFFFAOYSA-N |
| XLogP | 14.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.02 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|