C47H66P2 — CID 102041236
benzyl-[3-[benzyl-[2,4,6-tri(propan-2-yl)phenyl]phosphanyl]propyl]-[2,4,6-tri(propan-2-yl)phenyl]phosphane (PubChem CID 102041236) has the molecular formula C47H66P2 and a molecular weight of 692.99 g/mol. Its IUPAC name is benzyl-[3-[benzyl-[2,4,6-tri(propan-2-yl)phenyl]phosphanyl]propyl]-[2,4,6-tri(propan-2-yl)phenyl]phosphane.
| Compound Name | benzyl-[3-[benzyl-[2,4,6-tri(propan-2-yl)phenyl]phosphanyl]propyl]-[2,4,6-tri(propan-2-yl)phenyl]phosphane |
|---|---|
| PubChem CID | 102041236 |
| Molecular Formula | C47H66P2 |
| Molecular Weight | 692.99 g/mol |
| Exact Mass | 692.46 |
| IUPAC Name | benzyl-[3-[benzyl-[2,4,6-tri(propan-2-yl)phenyl]phosphanyl]propyl]-[2,4,6-tri(propan-2-yl)phenyl]phosphane |
| SMILES | CC(C)c1cc(C(C)C)c(P(CCCP(Cc2ccccc2)c2c(C(C)C)cc(C(C)C)cc2C(C)C)Cc2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C47H66P2/c1-32(2)40-26-42(34(5)6)46(43(27-40)35(7)8)48(30-38-20-15-13-16-21-38)24-19-25-49(31-39-22-17-14-18-23-39)47-44(36(9)10)28-41(33(3)4)29-45(47)37(11)12/h13-18,20-23,26-29,32-37H,19,24-25,30-31H2,1-12H3 |
| InChIKey | NIAQUEYSDVLVSZ-UHFFFAOYSA-N |
| XLogP | 14.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.99 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|