C34H38 — CID 173006325
2-(4-benzhydrylphenyl)-1,3,5-tri(propan-2-yl)benzene (PubChem CID 173006325) has the molecular formula C34H38 and a molecular weight of 446.68 g/mol. Its IUPAC name is 2-(4-benzhydrylphenyl)-1,3,5-tri(propan-2-yl)benzene.
| Compound Name | 2-(4-benzhydrylphenyl)-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 173006325 |
| Molecular Formula | C34H38 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 2-(4-benzhydrylphenyl)-1,3,5-tri(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(C(C)C)c(-c2ccc(C(c3ccccc3)c3ccccc3)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C34H38/c1-23(2)30-21-31(24(3)4)34(32(22-30)25(5)6)29-19-17-28(18-20-29)33(26-13-9-7-10-14-26)27-15-11-8-12-16-27/h7-25,33H,1-6H3 |
| InChIKey | SXAYZYBPPNAHBF-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|