C41H44O3 — CID 23156082
2,6-bis[(2-hydroxy-5-propan-2-ylphenyl)-phenylmethyl]-4-propan-2-ylphenol (PubChem CID 23156082) has the molecular formula C41H44O3 and a molecular weight of 584.80 g/mol. Its IUPAC name is 2,6-bis[(2-hydroxy-5-propan-2-ylphenyl)-phenylmethyl]-4-propan-2-ylphenol.
| Compound Name | 2,6-bis[(2-hydroxy-5-propan-2-ylphenyl)-phenylmethyl]-4-propan-2-ylphenol |
|---|---|
| PubChem CID | 23156082 |
| Molecular Formula | C41H44O3 |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | 2,6-bis[(2-hydroxy-5-propan-2-ylphenyl)-phenylmethyl]-4-propan-2-ylphenol |
| SMILES | CC(C)c1ccc(O)c(C(c2ccccc2)c2cc(C(C)C)cc(C(c3ccccc3)c3cc(C(C)C)ccc3O)c2O)c1 |
| InChI | InChI=1S/C41H44O3/c1-25(2)30-17-19-37(42)33(21-30)39(28-13-9-7-10-14-28)35-23-32(27(5)6)24-36(41(35)44)40(29-15-11-8-12-16-29)34-22-31(26(3)4)18-20-38(34)43/h7-27,39-40,42-44H,1-6H3 |
| InChIKey | JJVAPZZWDQMZQN-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|