C36H48N2O — CID 174678037
bis(4-phenyl-3,5-di(propan-2-yl)aniline);hydrate (PubChem CID 174678037) has the molecular formula C36H48N2O and a molecular weight of 524.79 g/mol. Its IUPAC name is bis(4-phenyl-3,5-di(propan-2-yl)aniline);hydrate.
| Compound Name | bis(4-phenyl-3,5-di(propan-2-yl)aniline);hydrate |
|---|---|
| PubChem CID | 174678037 |
| Molecular Formula | C36H48N2O |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.38 |
| IUPAC Name | bis(4-phenyl-3,5-di(propan-2-yl)aniline);hydrate |
| SMILES | CC(C)c1cc(N)cc(C(C)C)c1-c1ccccc1.CC(C)c1cc(N)cc(C(C)C)c1-c1ccccc1.O |
| InChI | InChI=1S/2C18H23N.H2O/c2*1-12(2)16-10-15(19)11-17(13(3)4)18(16)14-8-6-5-7-9-14;/h2*5-13H,19H2,1-4H3;1H2 |
| InChIKey | WRYHDJNWCADIRT-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|