C34H40P+ — CID 86735896
triphenyl-[[2,4,6-tri(propan-2-yl)phenyl]methyl]phosphanium (PubChem CID 86735896) has the molecular formula C34H40P+ and a molecular weight of 479.67 g/mol. Its IUPAC name is triphenyl-[[2,4,6-tri(propan-2-yl)phenyl]methyl]phosphanium.
| Compound Name | triphenyl-[[2,4,6-tri(propan-2-yl)phenyl]methyl]phosphanium |
|---|---|
| PubChem CID | 86735896 |
| Molecular Formula | C34H40P+ |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | triphenyl-[[2,4,6-tri(propan-2-yl)phenyl]methyl]phosphanium |
| SMILES | CC(C)c1cc(C(C)C)c(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C34H40P/c1-25(2)28-22-32(26(3)4)34(33(23-28)27(5)6)24-35(29-16-10-7-11-17-29,30-18-12-8-13-19-30)31-20-14-9-15-21-31/h7-23,25-27H,24H2,1-6H3/q+1 |
| InChIKey | VZVZZKOKNWRKAT-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|