C20H37Cl — CID 143865267
2-(chloromethyl)-1,3,5-tri(propan-2-yl)benzene;ethane (PubChem CID 143865267) has the molecular formula C20H37Cl and a molecular weight of 312.97 g/mol. Its IUPAC name is 2-(chloromethyl)-1,3,5-tri(propan-2-yl)benzene;ethane.
| Compound Name | 2-(chloromethyl)-1,3,5-tri(propan-2-yl)benzene;ethane |
|---|---|
| PubChem CID | 143865267 |
| Molecular Formula | C20H37Cl |
| Molecular Weight | 312.97 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | 2-(chloromethyl)-1,3,5-tri(propan-2-yl)benzene;ethane |
| SMILES | CC.CC.CC(C)c1cc(C(C)C)c(CCl)c(C(C)C)c1 |
| InChI | InChI=1S/C16H25Cl.2C2H6/c1-10(2)13-7-14(11(3)4)16(9-17)15(8-13)12(5)6;2*1-2/h7-8,10-12H,9H2,1-6H3;2*1-2H3 |
| InChIKey | BOBXKKVYIOIDCT-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.97 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|