C32H53Si+ — CID 102529639
ethyl-bis[2,4,6-tri(propan-2-yl)phenyl]silanylium (PubChem CID 102529639) has the molecular formula C32H53Si+ and a molecular weight of 465.86 g/mol. Its IUPAC name is ethyl-bis[2,4,6-tri(propan-2-yl)phenyl]silanylium.
| Compound Name | ethyl-bis[2,4,6-tri(propan-2-yl)phenyl]silanylium |
|---|---|
| PubChem CID | 102529639 |
| Molecular Formula | C32H53Si+ |
| Molecular Weight | 465.86 g/mol |
| Exact Mass | 465.39 |
| IUPAC Name | ethyl-bis[2,4,6-tri(propan-2-yl)phenyl]silanylium |
| SMILES | CC[SiH2+](c1c(C(C)C)cc(C(C)C)cc1C(C)C)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C32H53Si/c1-14-33(31-27(21(6)7)15-25(19(2)3)16-28(31)22(8)9)32-29(23(10)11)17-26(20(4)5)18-30(32)24(12)13/h15-24H,14,33H2,1-13H3/q+1 |
| InChIKey | FEUHCQBIIAOJPL-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.86 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|