C19H30 — CID 146002714
2-(2-methylprop-2-enyl)-1,3,5-tri(propan-2-yl)benzene (PubChem CID 146002714) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)-1,3,5-tri(propan-2-yl)benzene.
| Compound Name | 2-(2-methylprop-2-enyl)-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 146002714 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 2-(2-methylprop-2-enyl)-1,3,5-tri(propan-2-yl)benzene |
| SMILES | C=C(C)Cc1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C19H30/c1-12(2)9-19-17(14(5)6)10-16(13(3)4)11-18(19)15(7)8/h10-11,13-15H,1,9H2,2-8H3 |
| InChIKey | YBAFGCVGJFBPRG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|