C36H46Cl2F2 — CID 169156498
1,4-dichloro-2,5-difluoro-3,6-bis[2,4,6-tri(propan-2-yl)phenyl]benzene (PubChem CID 169156498) has the molecular formula C36H46Cl2F2 and a molecular weight of 587.67 g/mol. Its IUPAC name is 1,4-dichloro-2,5-difluoro-3,6-bis[2,4,6-tri(propan-2-yl)phenyl]benzene.
| Compound Name | 1,4-dichloro-2,5-difluoro-3,6-bis[2,4,6-tri(propan-2-yl)phenyl]benzene |
|---|---|
| PubChem CID | 169156498 |
| Molecular Formula | C36H46Cl2F2 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | 1,4-dichloro-2,5-difluoro-3,6-bis[2,4,6-tri(propan-2-yl)phenyl]benzene |
| SMILES | CC(C)c1cc(C(C)C)c(-c2c(F)c(Cl)c(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c(F)c2Cl)c(C(C)C)c1 |
| InChI | InChI=1S/C36H46Cl2F2/c1-17(2)23-13-25(19(5)6)29(26(14-23)20(7)8)31-33(37)36(40)32(34(38)35(31)39)30-27(21(9)10)15-24(18(3)4)16-28(30)22(11)12/h13-22H,1-12H3 |
| InChIKey | OSGBNEKPFRMHEI-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|