C9H9Cl2F — CID 118361843
1,5-dichloro-2-fluoro-3-propan-2-ylbenzene (PubChem CID 118361843) has the molecular formula C9H9Cl2F and a molecular weight of 207.07 g/mol. Its IUPAC name is 1,5-dichloro-2-fluoro-3-propan-2-ylbenzene.
| Compound Name | 1,5-dichloro-2-fluoro-3-propan-2-ylbenzene |
|---|---|
| PubChem CID | 118361843 |
| Molecular Formula | C9H9Cl2F |
| Molecular Weight | 207.07 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 1,5-dichloro-2-fluoro-3-propan-2-ylbenzene |
| SMILES | CC(C)c1cc(Cl)cc(Cl)c1F |
| InChI | InChI=1S/C9H9Cl2F/c1-5(2)7-3-6(10)4-8(11)9(7)12/h3-5H,1-2H3 |
| InChIKey | CIHJKPXSVOOSMQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.07 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|