C10H11Cl2F — CID 118359557
1,5-dichloro-2-fluoro-3-(2-methylpropyl)benzene (PubChem CID 118359557) has the molecular formula C10H11Cl2F and a molecular weight of 221.10 g/mol. Its IUPAC name is 1,5-dichloro-2-fluoro-3-(2-methylpropyl)benzene.
| Compound Name | 1,5-dichloro-2-fluoro-3-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 118359557 |
| Molecular Formula | C10H11Cl2F |
| Molecular Weight | 221.10 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 1,5-dichloro-2-fluoro-3-(2-methylpropyl)benzene |
| SMILES | CC(C)Cc1cc(Cl)cc(Cl)c1F |
| InChI | InChI=1S/C10H11Cl2F/c1-6(2)3-7-4-8(11)5-9(12)10(7)13/h4-6H,3H2,1-2H3 |
| InChIKey | MSFBSUUIBDKDHM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.10 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|