C15H22Cl2 — CID 141214652
2,4-dichloro-3-methyl-1,5-bis(2-methylpropyl)benzene (PubChem CID 141214652) has the molecular formula C15H22Cl2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2,4-dichloro-3-methyl-1,5-bis(2-methylpropyl)benzene.
| Compound Name | 2,4-dichloro-3-methyl-1,5-bis(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 141214652 |
| Molecular Formula | C15H22Cl2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2,4-dichloro-3-methyl-1,5-bis(2-methylpropyl)benzene |
| SMILES | Cc1c(Cl)c(CC(C)C)cc(CC(C)C)c1Cl |
| InChI | InChI=1S/C15H22Cl2/c1-9(2)6-12-8-13(7-10(3)4)15(17)11(5)14(12)16/h8-10H,6-7H2,1-5H3 |
| InChIKey | YYHRZJKIYKEVRW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |