About 5-chloro-2,3-bis(2-methylpropyl)thiophene
5-chloro-2,3-bis(2-methylpropyl)thiophene (PubChem CID 175272669) has the molecular formula C12H19ClS
and a molecular weight of 230.80 g/mol. Its IUPAC name is 5-chloro-2,3-bis(2-methylpropyl)thiophene.
Molecular Properties
| Compound Name | 5-chloro-2,3-bis(2-methylpropyl)thiophene |
| PubChem CID | 175272669 |
| Molecular Formula | C12H19ClS |
| Molecular Weight | 230.80 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 5-chloro-2,3-bis(2-methylpropyl)thiophene |
| SMILES | CC(C)Cc1cc(Cl)sc1CC(C)C |
| InChI | InChI=1S/C12H19ClS/c1-8(2)5-10-7-12(13)14-11(10)6-9(3)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | AHJXXMDBHJMOJE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.80 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-2,3-bis(2-methylpropyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,3-bis(2-methylpropyl)thiophene?
The IUPAC name of 5-chloro-2,3-bis(2-methylpropyl)thiophene (CID 175272669) is 5-chloro-2,3-bis(2-methylpropyl)thiophene.
What is the SMILES notation for 5-chloro-2,3-bis(2-methylpropyl)thiophene?
The canonical SMILES for 5-chloro-2,3-bis(2-methylpropyl)thiophene is CC(C)Cc1cc(Cl)sc1CC(C)C.
What is the InChIKey of 5-chloro-2,3-bis(2-methylpropyl)thiophene?
The InChIKey is AHJXXMDBHJMOJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClS/c1-8(2)5-10-7-12(13)14-11(10)6-9(3)4/h7-9H,5-6H2,1-4H3.
What are the key properties of 5-chloro-2,3-bis(2-methylpropyl)thiophene?
5-chloro-2,3-bis(2-methylpropyl)thiophene has a molecular weight of 230.80 g/mol, XLogP of 4.80, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,3-bis(2-methylpropyl)thiophene is sourced from PubChem (CID 175272669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).