C12H19ClS — CID 175272669
5-chloro-2,3-bis(2-methylpropyl)thiophene (PubChem CID 175272669) has the molecular formula C12H19ClS and a molecular weight of 230.80 g/mol. Its IUPAC name is 5-chloro-2,3-bis(2-methylpropyl)thiophene.
| Compound Name | 5-chloro-2,3-bis(2-methylpropyl)thiophene |
|---|---|
| PubChem CID | 175272669 |
| Molecular Formula | C12H19ClS |
| Molecular Weight | 230.80 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 5-chloro-2,3-bis(2-methylpropyl)thiophene |
| SMILES | CC(C)Cc1cc(Cl)sc1CC(C)C |
| InChI | InChI=1S/C12H19ClS/c1-8(2)5-10-7-12(13)14-11(10)6-9(3)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | AHJXXMDBHJMOJE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.80 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |