C8H12ClNS — CID 130516681
2-chloro-4-methyl-5-(2-methylpropyl)-1,3-thiazole (PubChem CID 130516681) has the molecular formula C8H12ClNS and a molecular weight of 189.71 g/mol. Its IUPAC name is 2-chloro-4-methyl-5-(2-methylpropyl)-1,3-thiazole.
| Compound Name | 2-chloro-4-methyl-5-(2-methylpropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 130516681 |
| Molecular Formula | C8H12ClNS |
| Molecular Weight | 189.71 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 2-chloro-4-methyl-5-(2-methylpropyl)-1,3-thiazole |
| SMILES | Cc1nc(Cl)sc1CC(C)C |
| InChI | InChI=1S/C8H12ClNS/c1-5(2)4-7-6(3)10-8(9)11-7/h5H,4H2,1-3H3 |
| InChIKey | KINBVEZFWDAZDA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.71 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |