C9H15NS2 — CID 82426539
[4-methyl-2-(2-methylpropyl)-1,3-thiazol-5-yl]methanethiol (PubChem CID 82426539) has the molecular formula C9H15NS2 and a molecular weight of 201.36 g/mol. Its IUPAC name is [4-methyl-2-(2-methylpropyl)-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [4-methyl-2-(2-methylpropyl)-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82426539 |
| Molecular Formula | C9H15NS2 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | [4-methyl-2-(2-methylpropyl)-1,3-thiazol-5-yl]methanethiol |
| SMILES | Cc1nc(CC(C)C)sc1CS |
| InChI | InChI=1S/C9H15NS2/c1-6(2)4-9-10-7(3)8(5-11)12-9/h6,11H,4-5H2,1-3H3 |
| InChIKey | BJWQTDAICAZVFS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|