C13H15NOS2 — CID 82426004
[4-methyl-2-[(4-methylphenoxy)methyl]-1,3-thiazol-5-yl]methanethiol (PubChem CID 82426004) has the molecular formula C13H15NOS2 and a molecular weight of 265.40 g/mol. Its IUPAC name is [4-methyl-2-[(4-methylphenoxy)methyl]-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [4-methyl-2-[(4-methylphenoxy)methyl]-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82426004 |
| Molecular Formula | C13H15NOS2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | [4-methyl-2-[(4-methylphenoxy)methyl]-1,3-thiazol-5-yl]methanethiol |
| SMILES | Cc1ccc(OCc2nc(C)c(CS)s2)cc1 |
| InChI | InChI=1S/C13H15NOS2/c1-9-3-5-11(6-4-9)15-7-13-14-10(2)12(8-16)17-13/h3-6,16H,7-8H2,1-2H3 |
| InChIKey | NSWGTMDUBVPNBX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|