C14H17NO2S2 — CID 82440431
[4-(methoxymethyl)-2-[(4-methylphenoxy)methyl]-1,3-thiazol-5-yl]methanethiol (PubChem CID 82440431) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is [4-(methoxymethyl)-2-[(4-methylphenoxy)methyl]-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [4-(methoxymethyl)-2-[(4-methylphenoxy)methyl]-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82440431 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | [4-(methoxymethyl)-2-[(4-methylphenoxy)methyl]-1,3-thiazol-5-yl]methanethiol |
| SMILES | COCc1nc(COc2ccc(C)cc2)sc1CS |
| InChI | InChI=1S/C14H17NO2S2/c1-10-3-5-11(6-4-10)17-8-14-15-12(7-16-2)13(9-18)19-14/h3-6,18H,7-9H2,1-2H3 |
| InChIKey | AKEZIBREFHAKHE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 31.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|