C11H17NS2 — CID 82436940
[4-cyclopropyl-2-(2-methylpropyl)-1,3-thiazol-5-yl]methanethiol (PubChem CID 82436940) has the molecular formula C11H17NS2 and a molecular weight of 227.40 g/mol. Its IUPAC name is [4-cyclopropyl-2-(2-methylpropyl)-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [4-cyclopropyl-2-(2-methylpropyl)-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82436940 |
| Molecular Formula | C11H17NS2 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | [4-cyclopropyl-2-(2-methylpropyl)-1,3-thiazol-5-yl]methanethiol |
| SMILES | CC(C)Cc1nc(C2CC2)c(CS)s1 |
| InChI | InChI=1S/C11H17NS2/c1-7(2)5-10-12-11(8-3-4-8)9(6-13)14-10/h7-8,13H,3-6H2,1-2H3 |
| InChIKey | VDQHYPKQBAYYOO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|