About (4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine
(4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine (PubChem CID 82435899) has the molecular formula C9H14N2S
and a molecular weight of 182.29 g/mol. Its IUPAC name is (4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine.
Analyze (4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine?
The IUPAC name of (4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine (CID 82435899) is (4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine.
What is the SMILES notation for (4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine?
The canonical SMILES for (4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine is CCc1nc(C2CC2)c(CN)s1.
What is the InChIKey of (4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine?
The InChIKey is KYWMKWJZAQSKMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2S/c1-2-8-11-9(6-3-4-6)7(5-10)12-8/h6H,2-5,10H2,1H3.
What are the key properties of (4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine?
(4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine has a molecular weight of 182.29 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclopropyl-2-ethyl-1,3-thiazol-5-yl)methanamine is sourced from PubChem (CID 82435899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).