C13H23N3S — CID 63915785
5-(aminomethyl)-4-cyclopropyl-N-methyl-N-pentyl-1,3-thiazol-2-amine (PubChem CID 63915785) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 5-(aminomethyl)-4-cyclopropyl-N-methyl-N-pentyl-1,3-thiazol-2-amine.
| Compound Name | 5-(aminomethyl)-4-cyclopropyl-N-methyl-N-pentyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63915785 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 5-(aminomethyl)-4-cyclopropyl-N-methyl-N-pentyl-1,3-thiazol-2-amine |
| SMILES | CCCCCN(C)c1nc(C2CC2)c(CN)s1 |
| InChI | InChI=1S/C13H23N3S/c1-3-4-5-8-16(2)13-15-12(10-6-7-10)11(9-14)17-13/h10H,3-9,14H2,1-2H3 |
| InChIKey | ZIJPOVBIABJWSX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|