C15H16FNOS2 — CID 82437168
[4-cyclopropyl-2-[2-(2-fluorophenoxy)ethyl]-1,3-thiazol-5-yl]methanethiol (PubChem CID 82437168) has the molecular formula C15H16FNOS2 and a molecular weight of 309.43 g/mol. Its IUPAC name is [4-cyclopropyl-2-[2-(2-fluorophenoxy)ethyl]-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [4-cyclopropyl-2-[2-(2-fluorophenoxy)ethyl]-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82437168 |
| Molecular Formula | C15H16FNOS2 |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | [4-cyclopropyl-2-[2-(2-fluorophenoxy)ethyl]-1,3-thiazol-5-yl]methanethiol |
| SMILES | Fc1ccccc1OCCc1nc(C2CC2)c(CS)s1 |
| InChI | InChI=1S/C15H16FNOS2/c16-11-3-1-2-4-12(11)18-8-7-14-17-15(10-5-6-10)13(9-19)20-14/h1-4,10,19H,5-9H2 |
| InChIKey | UZCSKMHMCXRLNA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|