C9H13NO2S3 — CID 82436819
[4-cyclopropyl-2-(methylsulfonylmethyl)-1,3-thiazol-5-yl]methanethiol (PubChem CID 82436819) has the molecular formula C9H13NO2S3 and a molecular weight of 263.41 g/mol. Its IUPAC name is [4-cyclopropyl-2-(methylsulfonylmethyl)-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [4-cyclopropyl-2-(methylsulfonylmethyl)-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82436819 |
| Molecular Formula | C9H13NO2S3 |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | [4-cyclopropyl-2-(methylsulfonylmethyl)-1,3-thiazol-5-yl]methanethiol |
| SMILES | CS(=O)(=O)Cc1nc(C2CC2)c(CS)s1 |
| InChI | InChI=1S/C9H13NO2S3/c1-15(11,12)5-8-10-9(6-2-3-6)7(4-13)14-8/h6,13H,2-5H2,1H3 |
| InChIKey | QEYRHNXRSGSIEV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|