C8H11Cl2NOS — CID 107961535
2-[(2,5-dichlorothiophen-3-yl)methylamino]propan-1-ol (PubChem CID 107961535) has the molecular formula C8H11Cl2NOS and a molecular weight of 240.15 g/mol. Its IUPAC name is 2-[(2,5-dichlorothiophen-3-yl)methylamino]propan-1-ol.
| Compound Name | 2-[(2,5-dichlorothiophen-3-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 107961535 |
| Molecular Formula | C8H11Cl2NOS |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 2-[(2,5-dichlorothiophen-3-yl)methylamino]propan-1-ol |
| SMILES | CC(CO)NCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H11Cl2NOS/c1-5(4-12)11-3-6-2-7(9)13-8(6)10/h2,5,11-12H,3-4H2,1H3 |
| InChIKey | DLXIRNFUYNVVBD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |