C10H17NO2 — CID 103880707
(2S)-2-[(2,5-dimethylfuran-3-yl)methylamino]propan-1-ol (PubChem CID 103880707) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (2S)-2-[(2,5-dimethylfuran-3-yl)methylamino]propan-1-ol.
| Compound Name | (2S)-2-[(2,5-dimethylfuran-3-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 103880707 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (2S)-2-[(2,5-dimethylfuran-3-yl)methylamino]propan-1-ol |
| SMILES | Cc1cc(CN[C@@H](C)CO)c(C)o1 |
| InChI | InChI=1S/C10H17NO2/c1-7(6-12)11-5-10-4-8(2)13-9(10)3/h4,7,11-12H,5-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | CVSNOMSBJMKNHG-ZETCQYMHSA-N |
| XLogP | 1.37 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |