C7H10O2 — CID 10396847
(2,5-dimethylfuran-3-yl)methanol (PubChem CID 10396847) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is (2,5-dimethylfuran-3-yl)methanol.
| Compound Name | (2,5-dimethylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 10396847 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | (2,5-dimethylfuran-3-yl)methanol |
| SMILES | Cc1cc(CO)c(C)o1 |
| InChI | InChI=1S/C7H10O2/c1-5-3-7(4-8)6(2)9-5/h3,8H,4H2,1-2H3 |
| InChIKey | YZKVNZQOYBRCPL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |