C9H12O3 — CID 59859508
3-(2,5-dimethylfuran-3-yl)propanoic acid (PubChem CID 59859508) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 3-(2,5-dimethylfuran-3-yl)propanoic acid.
| Compound Name | 3-(2,5-dimethylfuran-3-yl)propanoic acid |
|---|---|
| PubChem CID | 59859508 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3-(2,5-dimethylfuran-3-yl)propanoic acid |
| SMILES | Cc1cc(CCC(=O)O)c(C)o1 |
| InChI | InChI=1S/C9H12O3/c1-6-5-8(7(2)12-6)3-4-9(10)11/h5H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | RAQOMOFGSUGYBF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |