C18H26O2S — CID 21429347
3-[3-[3-(2,5-dimethylfuran-3-yl)propylsulfanyl]propyl]-2,5-dimethylfuran (PubChem CID 21429347) has the molecular formula C18H26O2S and a molecular weight of 306.47 g/mol. Its IUPAC name is 3-[3-[3-(2,5-dimethylfuran-3-yl)propylsulfanyl]propyl]-2,5-dimethylfuran.
| Compound Name | 3-[3-[3-(2,5-dimethylfuran-3-yl)propylsulfanyl]propyl]-2,5-dimethylfuran |
|---|---|
| PubChem CID | 21429347 |
| Molecular Formula | C18H26O2S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 3-[3-[3-(2,5-dimethylfuran-3-yl)propylsulfanyl]propyl]-2,5-dimethylfuran |
| SMILES | Cc1cc(CCCSCCCc2cc(C)oc2C)c(C)o1 |
| InChI | InChI=1S/C18H26O2S/c1-13-11-17(15(3)19-13)7-5-9-21-10-6-8-18-12-14(2)20-16(18)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | AIMXZDZVDWKZBC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|