C9H13NO3 — CID 55293673
(3R)-3-amino-3-(2,5-dimethylfuran-3-yl)propanoic acid (PubChem CID 55293673) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (3R)-3-amino-3-(2,5-dimethylfuran-3-yl)propanoic acid.
| Compound Name | (3R)-3-amino-3-(2,5-dimethylfuran-3-yl)propanoic acid |
|---|---|
| PubChem CID | 55293673 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (3R)-3-amino-3-(2,5-dimethylfuran-3-yl)propanoic acid |
| SMILES | Cc1cc([C@H](N)CC(=O)O)c(C)o1 |
| InChI | InChI=1S/C9H13NO3/c1-5-3-7(6(2)13-5)8(10)4-9(11)12/h3,8H,4,10H2,1-2H3,(H,11,12)/t8-/m1/s1 |
| InChIKey | RAEPFNVUTNSHPC-MRVPVSSYSA-N |
| XLogP | 1.37 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |