C11H18O — CID 15522203
2,5-dimethyl-3-pentylfuran (PubChem CID 15522203) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 2,5-dimethyl-3-pentylfuran.
| Compound Name | 2,5-dimethyl-3-pentylfuran |
|---|---|
| PubChem CID | 15522203 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2,5-dimethyl-3-pentylfuran |
| SMILES | CCCCCc1cc(C)oc1C |
| InChI | InChI=1S/C11H18O/c1-4-5-6-7-11-8-9(2)12-10(11)3/h8H,4-7H2,1-3H3 |
| InChIKey | PTCNSKLNDCSVAT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|