About 2-methyl-3-pentylfuran
2-methyl-3-pentylfuran (PubChem CID 12555082) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-methyl-3-pentylfuran.
Molecular Properties
| Compound Name | 2-methyl-3-pentylfuran |
| PubChem CID | 12555082 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 2-methyl-3-pentylfuran |
| SMILES | CCCCCc1ccoc1C |
| InChI | InChI=1S/C10H16O/c1-3-4-5-6-10-7-8-11-9(10)2/h7-8H,3-6H2,1-2H3 |
| InChIKey | PLEQYDKDTDGVOD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-pentylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-pentylfuran?
The IUPAC name of 2-methyl-3-pentylfuran (CID 12555082) is 2-methyl-3-pentylfuran.
What is the SMILES notation for 2-methyl-3-pentylfuran?
The canonical SMILES for 2-methyl-3-pentylfuran is CCCCCc1ccoc1C.
What is the InChIKey of 2-methyl-3-pentylfuran?
The InChIKey is PLEQYDKDTDGVOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-3-4-5-6-10-7-8-11-9(10)2/h7-8H,3-6H2,1-2H3.
What are the key properties of 2-methyl-3-pentylfuran?
2-methyl-3-pentylfuran has a molecular weight of 152.24 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-pentylfuran is sourced from PubChem (CID 12555082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).