About 3-heptylfuran-2-amine
3-heptylfuran-2-amine (PubChem CID 90951825) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-heptylfuran-2-amine.
Molecular Properties
| Compound Name | 3-heptylfuran-2-amine |
| PubChem CID | 90951825 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3-heptylfuran-2-amine |
| SMILES | CCCCCCCc1ccoc1N |
| InChI | InChI=1S/C11H19NO/c1-2-3-4-5-6-7-10-8-9-13-11(10)12/h8-9H,2-7,12H2,1H3 |
| InChIKey | YYCJCVAUNVOCQP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-heptylfuran-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptylfuran-2-amine?
The IUPAC name of 3-heptylfuran-2-amine (CID 90951825) is 3-heptylfuran-2-amine.
What is the SMILES notation for 3-heptylfuran-2-amine?
The canonical SMILES for 3-heptylfuran-2-amine is CCCCCCCc1ccoc1N.
What is the InChIKey of 3-heptylfuran-2-amine?
The InChIKey is YYCJCVAUNVOCQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-2-3-4-5-6-7-10-8-9-13-11(10)12/h8-9H,2-7,12H2,1H3.
What are the key properties of 3-heptylfuran-2-amine?
3-heptylfuran-2-amine has a molecular weight of 181.28 g/mol, XLogP of 3.37, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptylfuran-2-amine is sourced from PubChem (CID 90951825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).