C13H14O4 — CID 68629882
3-(7-methoxy-2-methyl-1-benzofuran-4-yl)propanoic acid (PubChem CID 68629882) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-(7-methoxy-2-methyl-1-benzofuran-4-yl)propanoic acid.
| Compound Name | 3-(7-methoxy-2-methyl-1-benzofuran-4-yl)propanoic acid |
|---|---|
| PubChem CID | 68629882 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-(7-methoxy-2-methyl-1-benzofuran-4-yl)propanoic acid |
| SMILES | COc1ccc(CCC(=O)O)c2cc(C)oc12 |
| InChI | InChI=1S/C13H14O4/c1-8-7-10-9(4-6-12(14)15)3-5-11(16-2)13(10)17-8/h3,5,7H,4,6H2,1-2H3,(H,14,15) |
| InChIKey | GQYRELDXDNXTNU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |