C5H7Cl3N2S — CID 154577383
(2,5-dichlorothiophen-3-yl)methylhydrazine;hydrochloride (PubChem CID 154577383) has the molecular formula C5H7Cl3N2S and a molecular weight of 233.55 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)methylhydrazine;hydrochloride.
| Compound Name | (2,5-dichlorothiophen-3-yl)methylhydrazine;hydrochloride |
|---|---|
| PubChem CID | 154577383 |
| Molecular Formula | C5H7Cl3N2S |
| Molecular Weight | 233.55 g/mol |
| Exact Mass | 231.94 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)methylhydrazine;hydrochloride |
| SMILES | Cl.NNCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C5H6Cl2N2S.ClH/c6-4-1-3(2-9-8)5(7)10-4;/h1,9H,2,8H2;1H |
| InChIKey | QTJNZVHIBFEMDJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|