About (2,5-dichlorothiophen-3-yl)methanamine;hydrochloride
(2,5-dichlorothiophen-3-yl)methanamine;hydrochloride (PubChem CID 71757986) has the molecular formula C5H6Cl3NS
and a molecular weight of 218.54 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)methanamine;hydrochloride.
Analyze (2,5-dichlorothiophen-3-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dichlorothiophen-3-yl)methanamine;hydrochloride?
The IUPAC name of (2,5-dichlorothiophen-3-yl)methanamine;hydrochloride (CID 71757986) is (2,5-dichlorothiophen-3-yl)methanamine;hydrochloride.
What is the SMILES notation for (2,5-dichlorothiophen-3-yl)methanamine;hydrochloride?
The canonical SMILES for (2,5-dichlorothiophen-3-yl)methanamine;hydrochloride is Cl.NCc1cc(Cl)sc1Cl.
What is the InChIKey of (2,5-dichlorothiophen-3-yl)methanamine;hydrochloride?
The InChIKey is JSRCERUVZGQZEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5Cl2NS.ClH/c6-4-1-3(2-8)5(7)9-4;/h1H,2,8H2;1H.
What are the key properties of (2,5-dichlorothiophen-3-yl)methanamine;hydrochloride?
(2,5-dichlorothiophen-3-yl)methanamine;hydrochloride has a molecular weight of 218.54 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dichlorothiophen-3-yl)methanamine;hydrochloride is sourced from PubChem (CID 71757986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).