C9H12Cl2NS2+ — CID 6929577
4-[(2,5-dichlorothiophen-3-yl)methyl]thiomorpholin-4-ium (PubChem CID 6929577) has the molecular formula C9H12Cl2NS2+ and a molecular weight of 269.24 g/mol. Its IUPAC name is 4-[(2,5-dichlorothiophen-3-yl)methyl]thiomorpholin-4-ium.
| Compound Name | 4-[(2,5-dichlorothiophen-3-yl)methyl]thiomorpholin-4-ium |
|---|---|
| PubChem CID | 6929577 |
| Molecular Formula | C9H12Cl2NS2+ |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 4-[(2,5-dichlorothiophen-3-yl)methyl]thiomorpholin-4-ium |
| SMILES | Clc1cc(C[NH+]2CCSCC2)c(Cl)s1 |
| InChI | InChI=1S/C9H11Cl2NS2/c10-8-5-7(9(11)14-8)6-12-1-3-13-4-2-12/h5H,1-4,6H2/p+1 |
| InChIKey | FEELUCMOTWATJL-UHFFFAOYSA-O |
| XLogP | 2.19 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |