C18H22ClN3O4S+2 — CID 9261828
1-[(5-chlorothiophen-2-yl)methyl]-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazine-1,4-diium (PubChem CID 9261828) has the molecular formula C18H22ClN3O4S+2 and a molecular weight of 411.91 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazine-1,4-diium.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 9261828 |
| Molecular Formula | C18H22ClN3O4S+2 |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazine-1,4-diium |
| SMILES | O=[N+]([O-])c1cc2c(c(C[NH+]3CC[NH+](Cc4ccc(Cl)s4)CC3)c1)OCOC2 |
| InChI | InChI=1S/C18H20ClN3O4S/c19-17-2-1-16(27-17)10-21-5-3-20(4-6-21)9-13-7-15(22(23)24)8-14-11-25-12-26-18(13)14/h1-2,7-8H,3-6,9-12H2/p+2 |
| InChIKey | KMULJFWXNCUGEC-UHFFFAOYSA-P |
| XLogP | 0.66 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|