C20H23ClN3O4+ — CID 8591046
1-(5-chloro-2-methylphenyl)-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazin-4-ium (PubChem CID 8591046) has the molecular formula C20H23ClN3O4+ and a molecular weight of 404.87 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazin-4-ium.
| Compound Name | 1-(5-chloro-2-methylphenyl)-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 8591046 |
| Molecular Formula | C20H23ClN3O4+ |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperazin-4-ium |
| SMILES | Cc1ccc(Cl)cc1N1CC[NH+](Cc2cc([N+](=O)[O-])cc3c2OCOC3)CC1 |
| InChI | InChI=1S/C20H22ClN3O4/c1-14-2-3-17(21)10-19(14)23-6-4-22(5-7-23)11-15-8-18(24(25)26)9-16-12-27-13-28-20(15)16/h2-3,8-10H,4-7,11-13H2,1H3/p+1 |
| InChIKey | VYNLWDUKXRZBBB-UHFFFAOYSA-O |
| XLogP | 2.33 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|