C16H14ClN3O5 — CID 75672141
4-chloro-N'-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]benzenecarboximidamide (PubChem CID 75672141) has the molecular formula C16H14ClN3O5 and a molecular weight of 363.76 g/mol. Its IUPAC name is 4-chloro-N'-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]benzenecarboximidamide.
| Compound Name | 4-chloro-N'-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 75672141 |
| Molecular Formula | C16H14ClN3O5 |
| Molecular Weight | 363.76 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 4-chloro-N'-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]benzenecarboximidamide |
| SMILES | NC(=NOCc1cc([N+](=O)[O-])cc2c1OCOC2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClN3O5/c17-13-3-1-10(2-4-13)16(18)19-25-8-12-6-14(20(21)22)5-11-7-23-9-24-15(11)12/h1-6H,7-9H2,(H2,18,19) |
| InChIKey | WMCYEZVWJFSHKY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.76 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|