C25H18ClN3O6 — CID 2080339
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate (PubChem CID 2080339) has the molecular formula C25H18ClN3O6 and a molecular weight of 491.89 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2080339 |
| Molecular Formula | C25H18ClN3O6 |
| Molecular Weight | 491.89 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18ClN3O6/c26-19-8-6-16(7-9-19)23-22(12-28(27-23)20-4-2-1-3-5-20)25(30)34-14-18-11-21(29(31)32)10-17-13-33-15-35-24(17)18/h1-12H,13-15H2 |
| InChIKey | WQEZIXNNHHJDDA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.89 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|