C20H19Cl2N3O5 — CID 46406182
N-(2,5-dichlorophenyl)-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]pyrrolidine-2-carboxamide (PubChem CID 46406182) has the molecular formula C20H19Cl2N3O5 and a molecular weight of 452.29 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 46406182 |
| Molecular Formula | C20H19Cl2N3O5 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | N-(2,5-dichlorophenyl)-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)C1CCCN1Cc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C20H19Cl2N3O5/c21-14-3-4-16(22)17(8-14)23-20(26)18-2-1-5-24(18)9-12-6-15(25(27)28)7-13-10-29-11-30-19(12)13/h3-4,6-8,18H,1-2,5,9-11H2,(H,23,26) |
| InChIKey | HBNNLMDPUGUQCW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|