C21H22ClFN2O4 — CID 112841794
N-(5-chloro-2-hydroxyphenyl)-1-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]piperidine-4-carboxamide (PubChem CID 112841794) has the molecular formula C21H22ClFN2O4 and a molecular weight of 420.87 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 112841794 |
| Molecular Formula | C21H22ClFN2O4 |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)C1CCN(Cc2cc(F)cc3c2OCOC3)CC1 |
| InChI | InChI=1S/C21H22ClFN2O4/c22-16-1-2-19(26)18(9-16)24-21(27)13-3-5-25(6-4-13)10-14-7-17(23)8-15-11-28-12-29-20(14)15/h1-2,7-9,13,26H,3-6,10-12H2,(H,24,27) |
| InChIKey | YRVKOCGIYJXZEF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|