C24H25ClN2O4 — CID 60512055
N-(5-chloro-2-hydroxyphenyl)-1-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]piperidine-4-carboxamide (PubChem CID 60512055) has the molecular formula C24H25ClN2O4 and a molecular weight of 440.93 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60512055 |
| Molecular Formula | C24H25ClN2O4 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc2c(CN3CCC(C(=O)Nc4cc(Cl)ccc4O)CC3)cc(=O)oc2c1C |
| InChI | InChI=1S/C24H25ClN2O4/c1-14-3-5-19-17(11-22(29)31-23(19)15(14)2)13-27-9-7-16(8-10-27)24(30)26-20-12-18(25)4-6-21(20)28/h3-6,11-12,16,28H,7-10,13H2,1-2H3,(H,26,30) |
| InChIKey | XQMGPHYEEGZJDG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|